Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 875-74-1, Name is H-D-Phg-OH, SMILES is O=C(O)[C@H](N)C1=CC=CC=C1, belongs to phthalazines compound. In a document, author is Villemin, Elise, introduce the new discover, Application In Synthesis of H-D-Phg-OH.
PHOSPHONATED BICYCLES BEARING A N-N JUNCTION
The Diels-Alder reaction between diethyl 1-phosphono-1,3-butadiene and cyclic azo dienophiles, such as 4-phenyl- and 4-methyl-1,2,4-triazoline-3,5-diones and phthalazine-1,4-dione gave access to phosphonated bicyclic cycloadducts bearing a N-N junction. Various functionalizations (dihydroxylation, hydrogenation and phosphonic ester deprotection) have been performed with success. The selective N-N cleavage was not possible for the preparation of large heterocycles. The coordination properties of selected bicycles were tested by ESI-HRMS.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 875-74-1 is helpful to your research. Application In Synthesis of H-D-Phg-OH.
Reference:
Phthalazine – Wikipedia,
,Phthalazine | C8H6N2 – PubChem