Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, COA of Formula: https://www.ambeed.com/products/35661-39-3.html, 35661-39-3, Name is Fmoc-Ala-OH, SMILES is C[C@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O, belongs to phthalazine compound. In a document, author is Hamidinasab, Mahdia, introduce the new discover.
The catalytic activity of four heterogeneous solid acid catalysts with magnetic core and sulfonic acid groups is evaluated and compared using one-pot three component synthesis of phthalazine-trione derivatives under solvent-free condition. The NiFe2O4 particles were selected as magnetic core, due to their enhanced chemical and magnetic stability. Furthermore, the desired products were obtained in excellent yields at short reaction times and environmentally friendly condition using the novel and reusable sulfonic acid grafted onto TiO2-coated nickel ferrite nanoparticles. This protocol avoids the use of expensive catalysts, toxic solvents and harsh reaction conditions.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 35661-39-3. COA of Formula: https://www.ambeed.com/products/35661-39-3.html.
Reference:
Phthalazine – Wikipedia,
,Phthalazine | C8H6N2 – PubChem