Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 886-86-2, Name is Ethyl 3-aminobenzoate methanesulfonate, SMILES is O=C(OCC)C1=CC=CC(N)=C1.CS(=O)(O)=O, belongs to phthalazine compound. In a document, author is Peric, Marko, introduce the new discover, Name: Ethyl 3-aminobenzoate methanesulfonate.
In this work we present the synthesis, and experimental and theoretical analysis of a binuclear nickel(II) complex coordinated to a new phthalazine dihydrazone-based ligand. Single-crystal X-ray diffraction analysis of the metal complex shows that the coordination geometry around each nickel(II) atom is distorted octahedral. DFT calculations predict that the magnetic exchange coupling constant of the binuclear nickel(II) complex is predominantly anti-ferromagnetic. [GRAPHICS] .
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 886-86-2 is helpful to your research. Name: Ethyl 3-aminobenzoate methanesulfonate.
Reference:
Phthalazine – Wikipedia,
,Phthalazine | C8H6N2 – PubChem