Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Computed Properties of https://www.ambeed.com/products/618-88-2.html, 618-88-2, Name is 5-Nitroisophthalic acid, SMILES is O=C(O)C1=CC([N+]([O-])=O)=CC(C(O)=O)=C1, belongs to phthalazine compound. In a document, author is Mayakrishnan, Sivakalai, introduce the new discover.
Rhodium catalysed dehydrogenative C-H/N-H functionalization was developed to construct phthalazino[2,3-a]-/indazolo[1,2-a]cinnolines by reacting N-phenyl phthalazine/indazole with alkynes. The synthesized compounds exhibit prominent fluorescence properties in solid and aggregation states. Their application in cell imaging was investigated using various cancer cell lines.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 618-88-2. Computed Properties of https://www.ambeed.com/products/618-88-2.html.
Reference:
Phthalazine – Wikipedia,
,Phthalazine | C8H6N2 – PubChem